logo
Home  > Naphthenic acids, zinc salts

AA33605

12001-85-3 | Naphthenic acids, zinc salts

Packsize Purity Availability Price Discounted Price    Quantity
25g 8% in stock $28.00 $20.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA33605
Chemical Name: Naphthenic acids, zinc salts
CAS Number: 12001-85-3
Molecular Formula: C20H34O4Zn
Molecular Weight: 403.86155999999994
MDL Number: MFCD00147699
SMILES: CCC1CCC(C1)CCC(=O)[O-].CCC1CCC(C1)CCC(=O)[O-].[Zn+2]

 

Upstream Synthesis Route 
  • Zinc naphthenate, a versatile chemical compound, is widely utilized in the field of chemical synthesis for its valuable applications. With its remarkable catalytic properties, Zinc naphthenate serves as a catalyst in various organic reactions, supporting the formation of crucial chemical bonds and facilitating the synthesis of complex molecules. Additionally, its ability to promote esterification and transesterification reactions makes it a valuable asset in the production of esters and related compounds. Furthermore, Zinc naphthenate plays a pivotal role in the synthesis of metal organic frameworks (MOFs), offering a platform for the creation of advanced porous materials with diverse applications in gas storage, separation, and catalysis. Its presence in chemical synthesis processes enables researchers and chemists to explore innovative pathways towards the development of novel materials and compounds, showcasing its significance in advancing the realm of modern chemistry.
FEATURED PRODUCTS