logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Pyridines  > N-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)acetamide

AA34083

1201645-46-6 | N-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)acetamide

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $50.00 $35.00 -   +
250mg 97% in stock $70.00 $49.00 -   +
1g 97% in stock $185.00 $130.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA34083
Chemical Name: N-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)acetamide
CAS Number: 1201645-46-6
Molecular Formula: C13H19BN2O3
Molecular Weight: 262.1126
MDL Number: MFCD11878288
SMILES: CC(=O)Nc1cncc(c1)B1OC(C(O1)(C)C)(C)C

 

Computed Properties
Complexity: 344  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 19  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 2  

 

 

Upstream Synthesis Route
  • N-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)acetamide is a versatile compound used in chemical synthesis as a key building block for the synthesis of various organic molecules. Specifically, it serves as a valuable intermediate in the preparation of pharmaceuticals, agrochemicals, and materials science applications. This compound plays a crucial role in the formation of complex molecular structures due to its unique reactivity and functional groups, making it a valuable tool for synthetic chemists striving to create novel compounds with specific properties and functions.
FEATURED PRODUCTS