AA34209
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $12.00 | $8.00 | - + | |
5mg | 99% | in stock | $26.00 | $18.00 | - + | |
10mg | 99% | in stock | $41.00 | $29.00 | - + | |
25mg | 99% | in stock | $58.00 | $41.00 | - + | |
50mg | 99% | in stock | $70.00 | $49.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA34209 |
Chemical Name: | 4-(Carboxymethyl)-2-((R)-1-(2-(2,5-dichlorobenzamido)acetamido)-3-methylbutyl)-6-oxo-1,3,2-dioxaborinane-4-carboxylic acid |
CAS Number: | 1201902-80-8 |
Molecular Formula: | C20H23BCl2N2O9 |
Molecular Weight: | 517.1216 |
MDL Number: | MFCD18251437 |
SMILES: | CC(C[C@@H](B1OC(=O)CC(O1)(CC(=O)O)C(=O)O)NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)C |
Complexity: | 815 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 10 |
Undefined Atom Stereocenter Count: | 1 |
The compound $name$ plays a crucial role in chemical synthesis as a versatile building block due to its unique structure and functional groups. It can be utilized as a key intermediate in the production of pharmaceuticals, agrochemicals, and advanced materials. With its carboxylic acid and boronic acid moieties, $name$ serves as a valuable reagent in various organic reactions such as Suzuki couplings, Heck reactions, and metal-catalyzed cross-coupling reactions. This enables the efficient formation of complex molecules and the modification of existing chemical structures with high precision and control. Furthermore, the presence of the amide and dichlorobenzamido groups in $name$ offers opportunities for diverse chemical transformations, making it a valuable asset in the realm of synthetic chemistry.
Future oncology (London, England) 20150101
Expert opinion on investigational drugs 20150101
Molecular & cellular proteomics : MCP 20121201
Nature medicine 20120106
Nature 20111214
Clinical cancer research : an official journal of the American Association for Cancer Research 20111201
Clinical cancer research : an official journal of the American Association for Cancer Research 20110815
Journal of medicinal chemistry 20110714
Cancer research 20100301