logo
Home  > 2H-Benzimidazol-2-one, 5-chloro-6-(2,3-dichlorophenoxy)-1,3-dihydro-

AA34206

1201920-88-8 | 2H-Benzimidazol-2-one, 5-chloro-6-(2,3-dichlorophenoxy)-1,3-dihydro-

Packsize Purity Availability Price Discounted Price    Quantity
10mg 2 weeks $701.00 $491.00 -   +
50mg 2 weeks $1,319.00 $923.00 -   +
100mg 2 weeks $2,232.00 $1,563.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA34206
Chemical Name: 2H-Benzimidazol-2-one, 5-chloro-6-(2,3-dichlorophenoxy)-1,3-dihydro-
CAS Number: 1201920-88-8
Molecular Formula: C13H7Cl3N2O2
Molecular Weight: 329.5659
MDL Number: MFCD16294832
SMILES: Clc1cc2[nH]c(=O)[nH]c2cc1Oc1cccc(c1Cl)Cl

 

Upstream Synthesis Route 
  • 5-Chloro-6-(2,3-dichlorophenoxy)-1H-benzo[d]imidazol-2(3H)-one, primarily known for its ability in chemical synthesis, serves as a valuable intermediate in various organic reactions. This compound is frequently utilized as a key building block in the creation of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure provides a versatile platform for the formation of diverse molecular structures, enabling the synthesis of complex compounds with specific properties and functions. In the realm of chemical synthesis, this compound plays a crucial role in the development of novel organic molecules with potential applications in drug discovery, materials science, and other fields of chemistry.
FEATURED PRODUCTS