logo
Home  > (2S,3S)-2-Isocyanato-3-methylvaleric acid methyl ester

AB54930

120219-17-2 | (2S,3S)-2-Isocyanato-3-methylvaleric acid methyl ester

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $181.00 $127.00 -   +
5g 98% in stock $590.00 $413.00 -   +
10g 98% in stock $1,084.00 $759.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB54930
Chemical Name: (2S,3S)-2-Isocyanato-3-methylvaleric acid methyl ester
CAS Number: 120219-17-2
Molecular Formula: C8H13NO3
Molecular Weight: 171.1937
MDL Number: MFCD00191534
SMILES: CC[C@@H]([C@@H](C(=O)OC)N=C=O)C

 

Upstream Synthesis Route 
  • (2S,3S)-Methyl 2-isocyanato-3-methylpentanoate is a valuable compound used in chemical synthesis for its chiral properties. This compound is commonly employed as a key building block in the preparation of various enantiomerically pure molecules and pharmaceutical intermediates. It serves as a versatile reagent in the creation of complex organic compounds due to its ability to participate in various types of reactions, such as nucleophilic addition, substitution, and cycloaddition reactions. Its stereochemistry plays a crucial role in controlling the stereochemical outcome of the overall synthesis process, making it a highly sought-after tool in asymmetric synthesis.Additionally, its unique structural features allow for efficient manipulation of the molecular framework, enabling chemists to access a wide range of structurally diverse and biologically active molecules for further research and development.
FEATURED PRODUCTS