AB52964
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $16.00 | $11.00 | - + | |
5mg | 98% | in stock | $22.00 | $15.00 | - + | |
10mg | 98% | in stock | $27.00 | $19.00 | - + | |
100mg | 98% | in stock | $52.00 | $37.00 | - + | |
250mg | 98% | in stock | $104.00 | $73.00 | - + | |
1g | 98% | in stock | $259.00 | $182.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52964 |
Chemical Name: | N-{3-[(5-Fluoro-2-{[4-(2-methoxyethoxy)phenyl]amino}pyrimidin-4-yl)amino]phenyl}prop-2-enamide |
CAS Number: | 1202757-89-8 |
Molecular Formula: | C22H22FN5O3 |
Molecular Weight: | 423.4402 |
MDL Number: | MFCD25976876 |
SMILES: | COCCOc1ccc(cc1)Nc1ncc(c(n1)Nc1cccc(c1)NC(=O)C=C)F |
The compound $name$ is a versatile tool in chemical synthesis, known for its unique ability to act as a key intermediate in the production of various pharmaceutical compounds. Specifically, its application lies in its role as a crucial building block for the synthesis of organic molecules with potent biological activities. Through strategic manipulation of its structure, $name$ can be utilized to introduce specific functional groups and stereochemical features necessary for the development of novel drug candidates. This compound serves as a valuable asset in the pharmaceutical industry, offering chemists a powerful tool to navigate complex synthetic pathways and accelerate the discovery of next-generation therapeutics.