AB75504
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $8.00 | $6.00 | - + | |
5g | 97% | in stock | $27.00 | $19.00 | - + | |
10g | 97% | in stock | $39.00 | $28.00 | - + | |
25g | 97% | in stock | $91.00 | $64.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB75504 |
Chemical Name: | Methyl 1-methylindole-6-carboxylate |
CAS Number: | 1204-32-6 |
Molecular Formula: | C11H11NO2 |
Molecular Weight: | 189.2105 |
MDL Number: | MFCD06245515 |
SMILES: | COC(=O)c1ccc2c(c1)n(C)cc2 |
Methyl 1-methyl-1H-indole-6-carboxylate is a versatile compound commonly used in chemical synthesis as a key building block. This compound serves as an important precursor in the creation of various complex molecules due to its unique structural properties and reactivity. In organic synthesis, Methyl 1-methyl-1H-indole-6-carboxylate can undergo various transformations such as acylation, alkylation, and cycloaddition reactions to yield a wide range of functionalized products. Its indole moiety imparts aromaticity and electron-rich character, making it a valuable component in the construction of heterocyclic compounds. Additionally, the presence of the ester group allows for facile modification through esterification or hydrolysis reactions, enabling further derivatization to tailor the compound for specific applications. This compound plays a crucial role in the development of pharmaceuticals, agrochemicals, and materials by providing a strategic starting point for the synthesis of diverse chemical structures.