AE11125
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $20.00 | $14.00 | - + | |
5mg | 95% | in stock | $36.00 | $25.00 | - + | |
50mg | 95% | in stock | $136.00 | $95.00 | - + | |
100mg | 95% | in stock | $222.00 | $156.00 | - + | |
250mg | 95% | in stock | $361.00 | $253.00 | - + | |
1g | 95% | in stock | $945.00 | $661.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11125 |
Chemical Name: | (5Z)-5-({2-[(3R)-3-Aminopiperidin-1-yl]-3-phenylphenyl}methylidene)-1,3-thiazolidine-2,4-dione |
CAS Number: | 1204144-28-4 |
Molecular Formula: | C21H21N3O2S |
Molecular Weight: | 379.4753 |
MDL Number: | MFCD25976757 |
SMILES: | N[C@@H]1CCCN(C1)c1c(cccc1c1ccccc1)/C=C/1SC(=O)NC1=O |
Complexity: | 602 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.6 |
AZD1208 is a potent and selective inhibitor of Pim kinases, which are a family of oncogenic serine/threonine kinases involved in cell survival, proliferation, and differentiation. In chemical synthesis, AZD1208 can be utilized as a molecular tool to investigate the role of Pim kinases in various cellular processes. Its ability to specifically target these kinases makes it a valuable compound for studying signaling pathways, protein phosphorylation events, and potential therapeutic interventions in cancer and other diseases. By incorporating AZD1208 into experimental designs, researchers can gain insights into the molecular mechanisms underlying disease progression and identify new strategies for drug development.
Journal of medicinal chemistry 20151112
ACS medicinal chemistry letters 20131212