AE19482
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | in stock | $562.00 | $393.00 | - + | ||
25mg | in stock | $1,570.00 | $1,099.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE19482 |
Chemical Name: | 2,19-Methano-3,7:4,1-dimetheno-1H,11H-14,10,2,9,11,17-benzoxathiatetraazacyclodocosine-8,18(9H,15H)-dione, 27-cyclohexyl-12,13,16,17-tetrahydro-22-methoxy-11,17-dimethyl-, 10,10-dioxide |
CAS Number: | 1204416-97-6 |
Molecular Formula: | C37H53N5O8S |
Molecular Weight: | 727.9104 |
MDL Number: | MFCD25976747 |
SMILES: | COc1ccc2-c3c(C4CCCCC4)c4c5n3CC(=Cc2c1)C(=O)N(C)CCOCCN(S(=O)(=O)NC(=O)c5ccc4)C |
The compound 2,19-Methano-3,7:4,1-dimetheno-1H,11H-14,10,2,9,11,17-benzoxathiatetraazacyclodocosine-8,18(9H,15H)-dione, 27-cyclohexyl-12,13,16,17-tetrahydro-22-methoxy-11,17-dimethyl-, 10,10-dioxide, is a versatile molecule used in chemical synthesis for its unique structural features. Its complex ring system and functional groups make it a valuable building block for the creation of novel compounds with diverse functionalities. By incorporating this compound into synthetic routes, chemists can access a wide range of molecular scaffolds and potentially develop new materials or pharmaceutical agents with enhanced properties.