AI13013
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $29.00 | $21.00 | - + | |
250mg | 97% | in stock | $72.00 | $51.00 | - + | |
10g | 97% | in stock | $2,625.00 | $1,837.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI13013 |
Chemical Name: | (7R,8aS)-tert-Butyl 7-hydroxyhexahydropyrrolo[1,2-a]pyrazine-2(1H)-carboxylate |
CAS Number: | 1204603-42-8 |
Molecular Formula: | C12H22N2O3 |
Molecular Weight: | 242.31467999999995 |
MDL Number: | MFCD15530244 |
SMILES: | O[C@H]1CN2[C@@H](C1)CN(CC2)C(=O)OC(C)(C)C |
Complexity: | 301 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.5 |
Tert-Butyl (7R,8aS)-7-hydroxyoctahydropyrrolo[1,2-a]piperazine-2-carboxylate is a versatile compound commonly employed in chemical synthesis due to its unique structural properties and reactivity. In chemical synthesis, this compound serves as a valuable building block for the creation of complex molecules, particularly in the realm of medicinal chemistry and drug development. By serving as a key intermediate, tert-Butyl (7R,8aS)-7-hydroxyoctahydropyrrolo[1,2-a]piperazine-2-carboxylate enables the synthesis of various pharmaceutical compounds with enhanced biological activity and efficacy. Its use in chemical synthesis facilitates the production of diverse chemical entities with potential applications in biotechnology, materials science, and organic chemistry.