AJ12832
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $163.00 | $114.00 | - + | |
250mg | 98% | in stock | $299.00 | $210.00 | - + | |
1g | 98% | in stock | $824.00 | $577.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AJ12832 |
Chemical Name: | O-(N-Biotiny-NH-(PEG)2-COOH·DIPEA |
CAS Number: | 1205744-09-7 |
Molecular Formula: | C33H63N5O8S |
Molecular Weight: | 689.9470200000003 |
MDL Number: | MFCD08458689 |
SMILES: | O=C(NCCCOCCOCCOCCCNC(=O)CCCC(=O)O)CCCC[C@@H]1SC[C@H]2[C@@H]1NC(=O)N2.CCN(C(C)C)C(C)C |
O-(N-Biotinyl-NH-(PEG)2-COOH·DIPEA is a versatile compound commonly used in chemical synthesis as a biotinylation reagent. This reagent plays a crucial role in linking biotin to other molecules, enabling researchers to label proteins, nucleic acids, antibodies, and other biomolecules for various applications in biochemical research. Its chemical structure, comprised of a biotin moiety connected to a dipeptide spacer arm with two polyethylene glycol (PEG) chains and a carboxylic acid functional group, allows for efficient and specific conjugation reactions. By utilizing O-(N-Biotinyl-NH-(PEG)2-COOH·DIPEA in chemical synthesis, scientists can accurately modify and functionalize target molecules for downstream assays, diagnostics, and therapeutics.