logo
Home  > 1-Boc-4-(2-aminoethyl)azepane

AI13056

1205748-73-7 | 1-Boc-4-(2-aminoethyl)azepane

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $341.00 $239.00 -   +
250mg 95% in stock $545.00 $382.00 -   +
500mg 95% in stock $907.00 $635.00 -   +
1g 95% in stock $1,360.00 $952.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI13056
Chemical Name: 1-Boc-4-(2-aminoethyl)azepane
CAS Number: 1205748-73-7
Molecular Formula: C13H26N2O2
Molecular Weight: 242.3577
MDL Number: MFCD14582367
SMILES: NCCC1CCCN(CC1)C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The tert-Butyl 4-(2-aminoethyl)azepane-1-carboxylate is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it an essential building block for the creation of various organic molecules. In chemical synthesis, this compound serves as a key intermediate in the preparation of pharmaceuticals, agrochemicals, and advanced materials. Its amino and carboxyl functional groups allow for selective modifications and derivatizations, making it a valuable tool for designing and producing complex molecular structures. Additionally, the tert-butyl group provides steric protection and enhances the compound's stability during reactions, ensuring high yields and purity in the synthesis process. Overall, tert-Butyl 4-(2-aminoethyl)azepane-1-carboxylate plays a crucial role in the development of innovative compounds with diverse applications in the field of chemistry.
FEATURED PRODUCTS