logo
Home  > Solcitinib

AE11465

1206163-45-2 | Solcitinib

Packsize Purity Availability Price Discounted Price    Quantity
1mg 98% in stock $20.00 $14.00 -   +
5mg 98% in stock $41.00 $29.00 -   +
10mg 98% in stock $59.00 $42.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE11465
Chemical Name: Solcitinib
CAS Number: 1206163-45-2
Molecular Formula: C22H23N5O2
Molecular Weight: 389.45031999999986
MDL Number: MFCD26960569
SMILES: O=C(C1CC1)Nc1nn2c(n1)cccc2c1ccc(cc1)C(=O)N1CC(C1)(C)C

 

Upstream Synthesis Route
  • Solicitinib is a potent and selective inhibitor of Janus kinase 1 (JAK1), a key enzyme involved in regulating various cellular processes. In chemical synthesis, Solicitinib plays a crucial role as a valuable tool for modulating JAK-STAT signaling pathways, which are essential for numerous cellular functions such as immune response, inflammation, and cell proliferation.By inhibiting JAK1, Solicitinib can be used in the development of targeted therapies for various autoimmune diseases, inflammatory disorders, and certain types of cancer. In chemical synthesis, Solicitinib's ability to selectively inhibit JAK1 activity allows for precise manipulation of signaling pathways, offering researchers a powerful method to study the underlying mechanisms of disease and develop novel treatments.Furthermore, Solicitinib's unique properties make it a versatile compound for designing and synthesizing new drug candidates with improved efficacy and reduced side effects. Its role in chemical synthesis extends beyond basic research, offering opportunities for the development of innovative pharmaceuticals that target specific disease pathways with higher precision and therapeutic outcomes.
FEATURED PRODUCTS