AV96722
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 3 weeks | $792.00 | $555.00 | - + | |
100mg | 95% | 3 weeks | $1,044.00 | $731.00 | - + | |
250mg | 95% | 3 weeks | $1,369.00 | $958.00 | - + | |
500mg | 95% | 3 weeks | $1,990.00 | $1,393.00 | - + | |
1g | 95% | 3 weeks | $2,469.00 | $1,729.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV96722 |
Chemical Name: | 3-(TRIFLUOROMETHYL)CYCLOHEXANE-1-SULFONAMIDE, Mixture of diastereomers |
CAS Number: | 1206679-32-4 |
Molecular Formula: | C7H12F3NO2S |
Molecular Weight: | 231.2359 |
MDL Number: | MFCD20410455 |
SMILES: | FC(C1CCCC(C1)S(=O)(=O)N)(F)F |