logo
Home  > Cis-1-N-Boc-3-methyl-piperidine-4-carboxylic acid

AE23173

1207267-93-3 | Cis-1-N-Boc-3-methyl-piperidine-4-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $128.00 $90.00 -   +
500mg 95% in stock $213.00 $149.00 -   +
1g 95% in stock $354.00 $248.00 -   +
5g 95% in stock $1,460.00 $1,022.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE23173
Chemical Name: Cis-1-N-Boc-3-methyl-piperidine-4-carboxylic acid
CAS Number: 1207267-93-3
Molecular Formula: C24H42N2O8
Molecular Weight: 486.5989
MDL Number: MFCD08436191
SMILES: C[C@H]1CN(CC[C@H]1C(=O)O)C(=O)OC(C)(C)C.C[C@@H]1CN(CC[C@@H]1C(=O)O)C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The (3R,4R)-rel-1-(tert-Butoxycarbonyl)-3-methylpiperidine-4-carboxylic acid is a versatile compound widely utilized in chemical synthesis as a chiral building block. Its unique stereochemistry and functional groups make it a valuable intermediate in the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. Specifically, this compound can be employed in the synthesis of complex molecules through asymmetric reactions, such as asymmetric hydrogenation, asymmetric aldol reactions, and asymmetric amination. Additionally, its tert-butoxycarbonyl (Boc) protecting group allows for selective manipulation of specific functional groups during synthetic transformations, enhancing the overall efficiency and selectivity of the synthetic process. This compound plays a crucial role in modern organic synthesis strategies aimed at constructing complex molecular architectures with high stereochemical control and specificity.
FEATURED PRODUCTS