AI13481
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | in stock | $432.00 | $302.00 | - + | |
250mg | 95% | in stock | $1,032.00 | $722.00 | - + | |
1g | 95% | in stock | $3,146.00 | $2,202.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI13481 |
Chemical Name: | 4-Fluoro-5-hydroxy-azepane-1-carboxylic acid tert-butyl ester |
CAS Number: | 1209780-33-5 |
Molecular Formula: | C11H20FNO3 |
Molecular Weight: | 233.2798 |
MDL Number: | MFCD16250807 |
SMILES: | OC1CCN(CCC1F)C(=O)OC(C)(C)C |
Complexity: | 252 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 2 |
XLogP3: | 1.4 |
The tert-Butyl 4-fluoro-5-hydroxyazepane-1-carboxylate compound finds valuable application in chemical synthesis as a versatile building block. This compound offers unique reactivity and functionality that make it a valuable precursor for the development of diverse organic molecules. Its incorporation into synthetic routes facilitates the introduction of both a fluorine and a hydroxyl group into target molecules, allowing for the manipulation of physicochemical properties and enhancing biological activity. Additionally, the tert-butyl group contributes steric hindrance and can serve as a protecting group, enabling selective functionalization at other reactive sites within a molecule. Through strategic utilization in chemical synthesis, tert-Butyl 4-fluoro-5-hydroxyazepane-1-carboxylate enables the efficient construction of complex molecular architectures with tailored properties and functionalities.