AB68089
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $11.00 | $8.00 | - + | |
10g | 98% | in stock | $14.00 | $10.00 | - + | |
25g | 98% | in stock | $17.00 | $12.00 | - + | |
100g | 98% | in stock | $39.00 | $27.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB68089 |
Chemical Name: | 2-Amino-5-nitrobenzotrifluoride |
CAS Number: | 121-01-7 |
Molecular Formula: | C7H5F3N2O2 |
Molecular Weight: | 206.122 |
MDL Number: | MFCD00007365 |
SMILES: | [O-][N+](=O)c1ccc(c(c1)C(F)(F)F)N |
Complexity: | 226 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2 |
The application of 4-Nitro-2-trifluoromethylaniline in chemical synthesis lies in its versatility as a key intermediate in the production of various organic compounds. This compound serves as a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Due to the unique properties of the trifluoromethyl group, 4-Nitro-2-trifluoromethylaniline plays a crucial role in introducing fluorine-containing motifs into complex molecules, enhancing their bioactivity and stability. Its presence in the chemical synthesis process enables the creation of novel compounds with improved properties, making it an essential component in the development of new materials and substances.
Acta crystallographica. Section C, Crystal structure communications 20020201