logo
Home  > L-Glutathione Oxidized Hexhydrate

AJ12826

121-24-4 | L-Glutathione Oxidized Hexhydrate

Packsize Purity Availability Price Discounted Price    Quantity
1g 99% in stock $58.00 $41.00 -   +
5g 99% in stock $152.00 $107.00 -   +
25g 99% in stock $564.00 $395.00 -   +
100g 99% in stock $1,989.00 $1,393.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AJ12826
Chemical Name: L-Glutathione Oxidized Hexhydrate
CAS Number: 121-24-4
Molecular Formula: C20H32N6O12S2
Molecular Weight: 612.6310800000002
MDL Number: MFCD00063106
SMILES: O=C(NC(C(=O)NCC(=O)O)CSSCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N)CCC(C(=O)O)N

 

Upstream Synthesis Route
  • The Glycine, L-γ-glutamyl-L-cysteinyl-, bimol. (2→2'')-disulfide is a versatile compound commonly used in chemical synthesis processes. This compound plays a crucial role in the formation of disulfide bonds, which are essential for stabilizing the structure of proteins and peptides.One of the key applications of Glycine, L-γ-glutamyl-L-cysteinyl-, bimol. (2→2'')-disulfide in chemical synthesis is in the production of peptide-based molecules. By facilitating the formation of disulfide bonds between cysteine residues, this compound aids in the correct folding and tertiary structure stabilization of peptides and proteins.In addition, Glycine, L-γ-glutamyl-L-cysteinyl-, bimol. (2→2'')-disulfide is commonly used as a cross-linking agent in bioconjugation reactions. Its ability to form stable disulfide linkages between biomolecules is particularly useful in the development of new bioconjugates and drug delivery systems.Overall, this compound's unique chemical properties make it a valuable tool in chemical synthesis for creating complex peptide structures, facilitating protein folding, and enabling the synthesis of novel bioconjugates.
FEATURED PRODUCTS