AJ12826
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 99% | in stock | $58.00 | $41.00 | - + | |
5g | 99% | in stock | $152.00 | $107.00 | - + | |
25g | 99% | in stock | $564.00 | $395.00 | - + | |
100g | 99% | in stock | $1,989.00 | $1,393.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AJ12826 |
Chemical Name: | L-Glutathione Oxidized Hexhydrate |
CAS Number: | 121-24-4 |
Molecular Formula: | C20H32N6O12S2 |
Molecular Weight: | 612.6310800000002 |
MDL Number: | MFCD00063106 |
SMILES: | O=C(NC(C(=O)NCC(=O)O)CSSCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N)CCC(C(=O)O)N |
The Glycine, L-γ-glutamyl-L-cysteinyl-, bimol. (2→2'')-disulfide is a versatile compound commonly used in chemical synthesis processes. This compound plays a crucial role in the formation of disulfide bonds, which are essential for stabilizing the structure of proteins and peptides.One of the key applications of Glycine, L-γ-glutamyl-L-cysteinyl-, bimol. (2→2'')-disulfide in chemical synthesis is in the production of peptide-based molecules. By facilitating the formation of disulfide bonds between cysteine residues, this compound aids in the correct folding and tertiary structure stabilization of peptides and proteins.In addition, Glycine, L-γ-glutamyl-L-cysteinyl-, bimol. (2→2'')-disulfide is commonly used as a cross-linking agent in bioconjugation reactions. Its ability to form stable disulfide linkages between biomolecules is particularly useful in the development of new bioconjugates and drug delivery systems.Overall, this compound's unique chemical properties make it a valuable tool in chemical synthesis for creating complex peptide structures, facilitating protein folding, and enabling the synthesis of novel bioconjugates.