logo
Home  > Chemistry  > Organic Building Blocks  > Sulfonic Acids  > 4-(Dimethylamino)benzenesulfonic acid

AD34099

121-58-4 | 4-(Dimethylamino)benzenesulfonic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $33.00 $23.00 -   +
5g 95% in stock $40.00 $28.00 -   +
20g 95% in stock $118.00 $83.00 -   +
25g 95% in stock $144.00 $101.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD34099
Chemical Name: 4-(Dimethylamino)benzenesulfonic acid
CAS Number: 121-58-4
Molecular Formula: C8H11NO3S
Molecular Weight: 201.24284
MDL Number: MFCD20269870
SMILES: CN(c1ccc(cc1)S(=O)(=O)O)C
NSC Number: 3540

 

Computed Properties
Complexity: 247  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 13  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 2  
XLogP3: 0.9  

 

 

Upstream Synthesis Route
  • 4-(Dimethylamino)benzenesulfonic acid, also known as DABS-Cl, is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This compound is commonly employed as a reagent in the production of peptides and proteins through solid-phase peptide synthesis (SPPS). In peptide synthesis, DABS-Cl is used as a coupling agent to facilitate the efficient and selective formation of peptide bonds between amino acids.Additionally, 4-(Dimethylamino)benzenesulfonic acid is utilized in the preparation of various specialty chemicals, pharmaceuticals, and dyes. Its sulfonic acid group allows for easy manipulation and functionalization, making it a valuable building block in organic synthesis. The presence of the dimethylamino group enhances the solubility and reactivity of the compound, making it a preferred choice for specific chemical reactions.Moreover, the unique molecular structure of DABS-Cl enables it to participate in nucleophilic aromatic substitution reactions, making it useful in the modification of aromatic compounds. This compound's ability to introduce functional groups selectively onto aromatic rings makes it a valuable tool in the design and synthesis of complex organic molecules with tailored properties.In summary, 4-(Dimethylamino)benzenesulfonic acid plays a crucial role in chemical synthesis as a versatile reagent for peptide synthesis, organic functionalization, and aromatic substitution reactions. Its diverse applications make it a valuable asset in the toolkit of synthetic chemists seeking efficient and selective methods for the preparation of a wide range of chemical compounds.
FEATURED PRODUCTS