logo
Home  > (1R,3S,4S)-3-(Boc-amino)-4-hydroxy-cyclohexanecarboxylic acid ethyl ester

AI13512

1210348-16-5 | (1R,3S,4S)-3-(Boc-amino)-4-hydroxy-cyclohexanecarboxylic acid ethyl ester

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $161.00 $113.00 -   +
250mg 95% in stock $201.00 $141.00 -   +
500mg 95% in stock $278.00 $194.00 -   +
1g 95% in stock $401.00 $281.00 -   +
5g 95% in stock $1,267.00 $887.00 -   +
10g 95% in stock $2,165.00 $1,516.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI13512
Chemical Name: (1R,3S,4S)-3-(Boc-amino)-4-hydroxy-cyclohexanecarboxylic acid ethyl ester
CAS Number: 1210348-16-5
Molecular Formula: C14H25NO5
Molecular Weight: 287.352
MDL Number: MFCD23106246
SMILES: CCOC(=O)[C@@H]1CC[C@@H]([C@H](C1)NC(=O)OC(C)(C)C)O

 

Upstream Synthesis Route 
  • Featuring the stereochemistry of (1R,3S,4S), (1R,3S,4S)-Ethyl 3-((tert-butoxycarbonyl)amino)-4-hydroxycyclohexanecarboxylate is a valuable compound widely utilized in chemical synthesis processes. Its unique structure lends itself to various applications in the creation of complex organic molecules, particularly in the field of medicinal chemistry and drug development. The compound serves as a versatile building block, contributing to the synthesis of pharmaceutical intermediates and bioactive compounds. Its selective functional groups make it particularly useful in the modification of molecular scaffolds, enabling the creation of diverse chemical architectures with specific stereochemical configurations. In addition, the presence of the tert-butoxycarbonyl protecting group enhances the compound's stability and facilitates controlled reactions during synthesis. Overall, (1R,3S,4S)-Ethyl 3-((tert-butoxycarbonyl)amino)-4-hydroxycyclohexanecarboxylate plays a crucial role in the construction of complex molecules with tailored properties and functionalities.
FEATURED PRODUCTS