logo
Home  > 4-Amino-4'-nitrobiphenyl

AB66622

1211-40-1 | 4-Amino-4'-nitrobiphenyl

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $69.00 $49.00 -   +
1g 95% in stock $204.00 $143.00 -   +
5g 95% in stock $689.00 $483.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB66622
Chemical Name: 4-Amino-4'-nitrobiphenyl
CAS Number: 1211-40-1
Molecular Formula: C12H10N2O2
Molecular Weight: 214.22
MDL Number: MFCD00093527
SMILES: Nc1ccc(cc1)c1ccc(cc1)[N+](=O)[O-]

 

Upstream Synthesis Route 
  • The 4'-Nitro-[1,1'-biphenyl]-4-amine is a valuable chemical compound widely used in chemical synthesis processes. In organic chemistry, this compound serves as a versatile building block for the synthesis of various functionalized molecules. Its nitro and amine functionalities provide sites for further modification, making it a crucial intermediate in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Additionally, the presence of a biphenyl backbone enhances the compound's stability and reactivity, allowing for efficient incorporation into complex molecular structures. This compound plays a significant role in the advancement of synthetic methodologies and the development of novel chemical compounds in the pharmaceutical and chemical industries.
FEATURED PRODUCTS