AI13543
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 960% | in stock | $25.00 | $17.00 | - + | |
250mg | 960% | in stock | $38.00 | $26.00 | - + | |
1g | 960% | in stock | $62.00 | $43.00 | - + | |
5g | 960% | in stock | $140.00 | $98.00 | - + | |
25g | 960% | in stock | $555.00 | $388.00 | - + | |
100g | 960% | in stock | $2,098.00 | $1,468.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI13543 |
Chemical Name: | Cefprozil monohydrate |
CAS Number: | 121123-17-9 |
Molecular Formula: | C18H21N3O6S |
Molecular Weight: | 407.4408 |
MDL Number: | MFCD00911719 |
SMILES: | C/C=C/C1=C(C(=O)O)N2[C@@H](SC1)[C@@H](C2=O)NC(=O)[C@@H](c1ccc(cc1)O)N.O |
Complexity: | 699 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 3 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 5 |
Rotatable Bond Count: | 5 |
Cefprozil monohydrate, a potent cephalosporin antibiotic, plays a crucial role in chemical synthesis processes. This compound is widely utilized as a key intermediate in the production of various pharmaceutical products, especially antibiotics. Its unique chemical structure allows for efficient functional group transformations and serves as a building block for more complex molecules. In organic synthesis, Cefprozil monohydrate can be selectively modified through various chemical reactions to introduce desirable functionalities, making it a valuable tool for medicinal chemistry research and drug development. Additionally, the high purity and stability of Cefprozil monohydrate make it a reliable choice for ensuring the quality and consistency of synthesized compounds.