AB79184
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $32.00 | $23.00 | - + | |
5g | 98% | in stock | $71.00 | $50.00 | - + | |
10g | 98% | in stock | $125.00 | $88.00 | - + | |
100g | 98% | in stock | $1,178.00 | $824.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79184 |
Chemical Name: | S-Phenyl benzenethiosulfonate |
CAS Number: | 1212-08-4 |
Molecular Formula: | C12H10O2S2 |
Molecular Weight: | 250.3366 |
MDL Number: | MFCD00014738 |
SMILES: | O=S(=O)(c1ccccc1)Sc1ccccc1 |
S-Phenyl benzenethiosulfonate is a versatile compound that finds wide application in chemical synthesis, particularly in organic chemistry. It serves as a key building block in the creation of various sulfur-containing compounds, offering unique reactivity and functional group compatibility. When utilized in chemical reactions, S-Phenyl benzenethiosulfonate can participate in nucleophilic substitution reactions to introduce sulfur functionality into organic molecules. This compound is valued for its ability to facilitate the formation of new carbon-sulfur bonds, enabling the synthesis of diverse molecular structures with sulfur moieties. In addition, S-Phenyl benzenethiosulfonate is employed as a sulfur transfer reagent in organic transformations, enabling the selective introduction of sulfur atoms into target molecules. Its role in chemical synthesis extends to the preparation of pharmaceutical intermediates, agrochemicals, and materials with tailored properties, showcasing its significance in the realm of organic synthesis.