1212278-30-2 | Cis-2-(((9h-fluoren-9-yl)methoxy)carbonylamino)cyclopent-3-ene-1-carboxylic acid

Availability
Typically In Stock

Description

• Catalog Number: AE61250
• Chemical Name: Cis-2-(((9h-fluoren-9-yl)methoxy)carbonylamino)cyclopent-3-ene-1-carboxylic acid
• CAS Number: 1212278-30-2
• Molecular Formula: C21H19NO4
• Molecular Weight: 349.3799
• MDL Number: MFCD11505077
• SMILES: O=C(N[C@H]1C=CC[C@H]1C(=O)O)OCC1c2ccccc2-c2c1cccc2

Upstream Synthesis Route

The cis-2-(((9H-Fluoren-9-yl)methoxy)carbonylamino)cyclopent-3-ene-1-carboxylic acid is a versatile compound widely used in chemical synthesis as a key building block for the creation of various complex organic molecules. Its unique structural properties make it a valuable tool in organic chemistry reactions, particularly in the field of drug discovery and development.One application of this compound in chemical synthesis is as a starting material for the synthesis of novel peptides and peptidomimetics. By incorporating cis-2-(((9H-Fluoren-9-yl)methoxy)carbonylamino)cyclopent-3-ene-1-carboxylic acid into peptide sequences, researchers can modulate the physicochemical properties and biological activities of the resulting peptides. This compound serves as a crucial linker that can enhance the stability, potency, and specificity of peptide-based drugs.Moreover, cis-2-(((9H-Fluoren-9-yl)methoxy)carbonylamino)cyclopent-3-ene-1-carboxylic acid can also be utilized in the synthesis of new materials with unique properties, such as polymers, dendrimers, and other macromolecular structures. Its functional groups enable selective chemical modifications and conjugations, allowing chemists to tailor the properties of the final materials for specific applications in nanotechnology, materials science, and biotechnology.In summary, the cis-2-(((9H-Fluoren-9-yl)methoxy)carbonylamino)cyclopent-3-ene-1-carboxylic acid plays a crucial role in advancing the field of chemical synthesis by enabling the efficient construction of diverse organic compounds with tailored properties and functionalities. Its versatility and reactivity make it a valuable tool for researchers seeking to develop innovative molecules with potential applications in various industries.