logo
Home  > Cis-3-(cbz-amino)cyclobutanecarboxylic acid

AE33164

1212380-76-1 | Cis-3-(cbz-amino)cyclobutanecarboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $135.00 $94.00 -   +
1g 95% in stock $297.00 $208.00 -   +
5g 95% in stock $914.00 $640.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE33164
Chemical Name: Cis-3-(cbz-amino)cyclobutanecarboxylic acid
CAS Number: 1212380-76-1
Molecular Formula: C13H15NO4
Molecular Weight: 249.2625
MDL Number: MFCD06659967
SMILES: O=C(N[C@@H]1C[C@@H](C1)C(=O)O)OCc1ccccc1

 

Upstream Synthesis Route 
  • cis-3-(((Benzyloxy)carbonyl)amino)cyclobutanecarboxylic acid is a versatile compound commonly used in chemical synthesis for its ability to serve as a protected amino acid derivative. This compound plays a crucial role in peptide synthesis as a key building block. Through strategic deprotection reactions, the benzyloxy carbonyl moiety can be selectively removed to unveil the amino group, enabling further functionalization and peptide bond formation. Additionally, the cyclobutane ring structure offers unique stereochemical properties that can be exploited in the development of complex molecules. This compound is a valuable tool for chemists involved in the synthesis of pharmaceuticals, natural products, and materials with specific stereochemical requirements.
FEATURED PRODUCTS