logo
Home  > Chemistry  > Organic Building Blocks  > Phenols  > 2'-Hydroxychalcone

AB44114

1214-47-7 | 2'-Hydroxychalcone

Packsize Purity Availability Price Discounted Price    Quantity
5g 95% in stock $19.00 $13.00 -   +
25g 95% in stock $34.00 $24.00 -   +
100g 95% in stock $79.00 $55.00 -   +
500g 95% in stock $249.00 $175.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB44114
Chemical Name: 2'-Hydroxychalcone
CAS Number: 1214-47-7
Molecular Formula: C15H12O2
Molecular Weight: 224.2546
MDL Number: MFCD00016441
SMILES: O=C(c1ccccc1O)/C=C/c1ccccc1

 

Computed Properties
Complexity: 277  
Covalently-Bonded Unit Count: 1  
Defined Bond Stereocenter Count: 1  
Heavy Atom Count: 17  
Hydrogen Bond Acceptor Count: 2  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 3  
XLogP3: 3.9  

 

 

Upstream Synthesis Route 
  • 1-(2-Hydroxyphenyl)-3-phenylprop-2-en-1-one, also known as $name$, is a versatile compound frequently used in chemical synthesis. This compound serves as a vital building block in the production of various pharmaceuticals, agrochemicals, and fine chemicals due to its unique structural properties. $name$ plays a crucial role in the creation of complex molecules through its involvement in various key reactions.One of the primary applications of $(name)$ in chemical synthesis is as a key intermediate in the synthesis of diverse heterocyclic compounds. Its reactivity allows for the formation of different ring structures, enabling the synthesis of compounds with various pharmacological activities. Additionally, $(name)$ is commonly employed in the preparation of chiral ligands and catalysts due to its ability to participate in asymmetric catalysis reactions.Moreover, $(name)$ finds utility in the production of organic materials and dyes, where its structure imparts specific color and functional properties to the final products. The compound's presence in these materials enhances their performance and provides a platform for further chemical modifications to tailor their properties for specific applications.In summary, 1-(2-Hydroxyphenyl)-3-phenylprop-2-en-1-one is a valuable compound in chemical synthesis, playing a crucial role in the development of various chemical entities across different industries. Its reactivity and structural features make it a versatile and indispensable component in the creation of new molecules with diverse applications.
Literature
FEATURED PRODUCTS