AE35820
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $42.00 | $29.00 | - + | |
5mg | 98+% | in stock | $83.00 | $58.00 | - + | |
10mg | 98+% | in stock | $117.00 | $82.00 | - + | |
25mg | 98+% | in stock | $166.00 | $117.00 | - + | |
50mg | 98+% | in stock | $237.00 | $166.00 | - + | |
100mg | 98+% | in stock | $340.00 | $238.00 | - + | |
250mg | 98+% | in stock | $522.00 | $365.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35820 |
Chemical Name: | N-(3-((5-chloro-2-((2-methoxy-4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidin-4-yl)oxy)phenyl)propionamide |
CAS Number: | 1214265-58-3 |
Molecular Formula: | C25H29ClN6O3 |
Molecular Weight: | 496.9892 |
MDL Number: | MFCD28015100 |
SMILES: | CCC(=O)Nc1cccc(c1)Oc1nc(ncc1Cl)Nc1ccc(cc1OC)N1CCN(CC1)C |
Complexity: | 667 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
XLogP3: | 4.1 |
Journal of cellular and molecular medicine 20170701
The Biochemical journal 20140715
The Biochemical journal 20140101