1214333-72-8 | 2-(3-Cloro-5-fluorophenyl)-2-hydroxyacetic acid

Availability
Typically In Stock

Description

• Catalog Number: BO20891
• Chemical Name: 2-(3-Cloro-5-fluorophenyl)-2-hydroxyacetic acid
• CAS Number: 1214333-72-8
• Molecular Formula: C8H6ClFO3
• Molecular Weight: 204.5828
• SMILES: Fc1cc(Cl)cc(c1)C(C(=O)O)O

Upstream Synthesis Route

The compound 2-(3-Chloro-5-fluorophenyl)-2-hydroxyacetic acid, also known as $name$, is a versatile chemical reagent widely used in chemical synthesis processes. Its unique molecular structure, containing both a hydroxy and carboxylic acid group, allows for it to participate in a variety of reactions and transformations.In organic synthesis, $name$ can serve as a key building block for the preparation of various pharmaceutical intermediates, agrochemicals, and fine chemicals. Its hydroxyacetic acid moiety can act as a versatile functional group for the introduction of additional substituents or modifications, while the chloro and fluoro substituents on the phenyl ring provide opportunities for selective derivatization.One common application of 2-(3-Chloro-5-fluorophenyl)-2-hydroxyacetic acid is in the synthesis of bioactive compounds, where its unique structure can be tailored to impart desired biological activities. Additionally, its ability to undergo reactions such as esterification, amidation, and nucleophilic substitution makes it a valuable reagent for the production of complex molecules in the pharmaceutical and agrochemical industries.Overall, the versatility and reactivity of 2-(3-Chloro-5-fluorophenyl)-2-hydroxyacetic acid make it a valuable tool for synthetic chemists seeking to access diverse chemical structures with potential applications in various fields.