AA52747
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $18.00 | $12.00 | - + | |
250mg | 95% | in stock | $30.00 | $21.00 | - + | |
1g | 95% | in stock | $49.00 | $34.00 | - + | |
5g | 95% | in stock | $226.00 | $158.00 | - + | |
25g | 95% | in stock | $796.00 | $557.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA52747 |
Chemical Name: | 3-Bromo-5-fluorobenzene-1-sulfonyl chloride |
CAS Number: | 1214342-44-5 |
Molecular Formula: | C6H3BrClFO2S |
Molecular Weight: | 273.5072232 |
MDL Number: | MFCD13185364 |
SMILES: | Fc1cc(Br)cc(c1)S(=O)(=O)Cl |
Complexity: | 251 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.7 |
3-Bromo-5-fluorobenzene-1-sulfonyl chloride is a versatile compound commonly used in chemical synthesis as a sulfonylating agent. Its reactivity and selectivity make it a valuable tool in organic chemistry, particularly in the functionalization of aromatic compounds. By introducing the sulfonyl chloride group, this compound allows for the modification of various functional groups on aromatic rings, enabling the creation of diverse chemical structures. Additionally, 3-Bromo-5-fluorobenzene-1-sulfonyl chloride can act as a building block for the synthesis of pharmaceuticals, agrochemicals, and materials, highlighting its importance in the field of organic synthesis.