logo
Home  > 3-(1-Phenyl-1h-benzo[d]imidazol-2-yl)phenylboronic acid

AA52960

1214723-26-8 | 3-(1-Phenyl-1h-benzo[d]imidazol-2-yl)phenylboronic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $44.00 $31.00 -   +
5g 95% in stock $573.00 $402.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA52960
Chemical Name: 3-(1-Phenyl-1h-benzo[d]imidazol-2-yl)phenylboronic acid
CAS Number: 1214723-26-8
Molecular Formula: C19H15BN2O2
Molecular Weight: 314.1456
MDL Number: MFCD16036282
SMILES: OB(c1cccc(c1)c1nc2c(n1c1ccccc1)cccc2)O

 

Upstream Synthesis Route
  • The (3-(1-Phenyl-1H-benzo[d]imidazol-2-yl)phenyl)boronic acid is a versatile compound that plays a crucial role in chemical synthesis. With its unique structure, it serves as a valuable building block in the development of various organic molecules. In particular, this compound is widely utilized in Suzuki-Miyaura coupling reactions, enabling the formation of carbon-carbon bonds in a controlled and efficient manner. Additionally, (3-(1-Phenyl-1H-benzo[d]imidazol-2-yl)phenyl)boronic acid is employed in the synthesis of pharmaceuticals, agrochemicals, and advanced materials due to its ability to introduce functional groups and enhance molecular diversity. Its compatibility with a wide range of reaction conditions further enhances its utility in synthetic chemistry, making it an essential tool for organic chemists seeking to create complex molecular structures with precision and efficiency.
FEATURED PRODUCTS