AA53139
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $137.00 | $96.00 | - + | |
5g | 95% | in stock | $386.00 | $270.00 | - + | |
10g | 95% | in stock | $572.00 | $400.00 | - + | |
25g | 95% | in stock | $945.00 | $661.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA53139 |
Chemical Name: | 4-Bromo-6-chloro-2-methylbenzoimidazole |
CAS Number: | 1215205-57-4 |
Molecular Formula: | C8H6BrClN2 |
Molecular Weight: | 245.5036 |
MDL Number: | MFCD22123685 |
SMILES: | Clc1cc(Br)c2c(c1)nc([nH]2)C |
Complexity: | 178 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 3.2 |
4-Bromo-6-chloro-2-methyl-1H-benzo[d]imidazole is a versatile chemical compound that finds extensive use in various chemical synthesis applications. This compound is a key building block in the synthesis of complex molecules due to its unique structure and reactivity.One of the prominent applications of 4-Bromo-6-chloro-2-methyl-1H-benzo[d]imidazole is in the pharmaceutical industry. It serves as a crucial intermediate in the synthesis of bioactive compounds, including pharmaceutical drugs and agrochemicals. Its structural features make it an ideal candidate for introducing specific functional groups or stereochemistry into target molecules.Additionally, this compound is utilized in the development of new materials and specialty chemicals. Its reactivity allows chemists to functionalize it further, leading to the creation of novel compounds with tailored properties. These materials have diverse applications ranging from electronics to polymers.In summary, 4-Bromo-6-chloro-2-methyl-1H-benzo[d]imidazole plays a significant role in chemical synthesis by serving as a versatile building block for the creation of complex molecules with diverse applications in pharmaceuticals, materials, and other industries.