AA53302
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $385.00 | $270.00 | - + | |
5mg | 95% | in stock | $1,442.00 | $1,009.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA53302 |
Chemical Name: | 9,13-Epoxy-1H,9H-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one, 2,3,10,11,12,13-hexahydro-3-hydroxy-10-methoxy-9-methyl-11-(methylamino)-, (3S,9S,10R,11R,13R)- |
CAS Number: | 121569-61-7 |
Molecular Formula: | C28H26N4O4 |
Molecular Weight: | 482.5304 |
MDL Number: | MFCD01729519 |
SMILES: | CNC1CC2OC(C1OC)(C)n1c3ccccc3c3c1c1n2c2ccccc2c1c1c3C(NC1=O)O |
The compound (3S,9S,10R,11R,13R)-2,3,10,11,12,13-Hexahydro-3-hydroxy-10-methoxy-9-methyl-11-(methylamino)-9,13-epoxy-1H,9H-diindolo[1,2,3-gh:3′,2′,1′-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one is commonly used in chemical synthesis as a versatile building block due to its unique structure and functional groups. It can serve as a key intermediate or starting material for the synthesis of complex bioactive molecules, natural products, or pharmaceutical compounds. This compound's stereochemistry and diverse chemical reactivity enable chemists to access a wide range of structurally diverse and biologically relevant compounds through strategic synthetic manipulations and transformations.