AE35909
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98+% | in stock | $10.00 | $7.00 | - + | |
5mg | 98+% | in stock | $22.00 | $16.00 | - + | |
10mg | 98+% | in stock | $31.00 | $22.00 | - + | |
50mg | 98+% | in stock | $102.00 | $71.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35909 |
Chemical Name: | GSK4112 |
CAS Number: | 1216744-19-2 |
Molecular Formula: | C18H21ClN2O4S |
Molecular Weight: | 396.8883 |
MDL Number: | MFCD12027224 |
SMILES: | O=C(OC(C)(C)C)CN(Cc1ccc(s1)[N+](=O)[O-])Cc1ccc(cc1)Cl |
Complexity: | 487 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 8 |
XLogP3: | 4.7 |
Bioorganic & medicinal chemistry letters 20130801
Bioorganic & medicinal chemistry letters 20120601
Nature 20120503
Biochemical and biophysical research communications 20120406
ACS chemical biology 20110218
ACS chemical biology 20101015