AA53961
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $60.00 | $42.00 | - + | |
250mg | 96% | in stock | $73.00 | $51.00 | - + | |
1g | 96% | in stock | $187.00 | $131.00 | - + | |
5g | 96% | in stock | $573.00 | $402.00 | - + | |
10g | 96% | in stock | $946.00 | $662.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA53961 |
Chemical Name: | 3-(N-Isopropyl-N-(4-methoxybenzyl)sulfamoyl)phenylboronic acid |
CAS Number: | 1217501-23-9 |
Molecular Formula: | C17H22BNO5S |
Molecular Weight: | 363.2363 |
MDL Number: | MFCD12756420 |
SMILES: | COc1ccc(cc1)CN(S(=O)(=O)c1cccc(c1)B(O)O)C(C)C |
Complexity: | 500 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
(3-(N-Isopropyl-N-(4-methoxybenzyl)sulfamoyl)phenyl)boronic acid is a versatile chemical compound commonly used in chemical synthesis. It serves as a valuable reagent in the construction of complex molecular structures, especially in the field of organic chemistry. This boronic acid derivative is frequently employed in Suzuki-Miyaura cross-coupling reactions, a widely utilized method for forming carbon-carbon bonds. Additionally, it can participate in various other coupling reactions such as Sonogashira, Stille, and Heck reactions, enabling the efficient and controlled synthesis of pharmaceuticals, agrochemicals, and advanced materials. Its unique structure and reactivity make it a crucial building block for creating diverse organic compounds with tailored functionalities.