AA54070
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $105.00 | $74.00 | - + | |
1g | 96% | in stock | $209.00 | $147.00 | - + | |
5g | 96% | in stock | $828.00 | $580.00 | - + | |
10g | 96% | in stock | $1,317.00 | $922.00 | - + | |
25g | 96% | in stock | $2,499.00 | $1,749.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA54070 |
Chemical Name: | Fmoc-3-(Boc-aminomethyl)-D-phenylalanine |
CAS Number: | 1217665-54-7 |
Molecular Formula: | C30H32N2O6 |
Molecular Weight: | 516.5849 |
MDL Number: | MFCD22205877 |
SMILES: | O=C(N[C@@H](C(=O)O)Cc1cccc(c1)CNC(=O)OC(C)(C)C)OCC1c2ccccc2-c2c1cccc2 |
Fmoc-3-(Boc-aminomethyl)-D-phenylalanine is a versatile compound widely used in chemical synthesis, specifically in peptide synthesis. This compound serves as a key building block in the creation of complex peptides due to its unique structure and reactivity.In peptide synthesis, Fmoc-3-(Boc-aminomethyl)-D-phenylalanine acts as a protected amino acid, enabling controlled addition of amino acids to the peptide chain. The Fmoc (Fluorenylmethyloxycarbonyl) and Boc (tert-butyloxycarbonyl) groups provide temporary protection to the amino and carboxyl functional groups, allowing for selective deprotection and coupling reactions to take place at specific stages of the synthesis process.The incorporation of Fmoc-3-(Boc-aminomethyl)-D-phenylalanine in peptide synthesis allows for the production of peptides with tailored structures and properties, making it an essential component in the creation of peptide-based drugs, biomaterials, and biochemical research tools.