AA54193
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $13.00 | $9.00 | - + | |
250mg | 95% | in stock | $19.00 | $13.00 | - + | |
1g | 95% | in stock | $48.00 | $34.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA54193 |
Chemical Name: | Fmoc-d-dab(mtt)-oh |
CAS Number: | 1217809-38-5 |
Molecular Formula: | C39H36N2O4 |
Molecular Weight: | 596.7141 |
MDL Number: | MFCD02094100 |
SMILES: | Cc1ccc(cc1)C(c1ccccc1)(c1ccccc1)NCC[C@H](C(=O)O)NC(=O)OCC1c2ccccc2-c2c1cccc2 |
Used as a versatile building block in chemical synthesis, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-((diphenyl(p-tolyl)methyl)amino)butanoic acid is a valuable compound for creating complex molecules with specific structural properties. This compound is particularly useful in the development of pharmaceuticals, agrochemicals, and materials science due to its ability to serve as a chiral scaffold for constructing biologically active compounds. Additionally, its unique molecular structure provides opportunities for modifying and functionalizing the molecule to tailor its properties for various synthetic pathways.