AE36339
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $96.00 | $67.00 | - + | |
1g | 95% | in stock | $193.00 | $135.00 | - + | |
5g | 95% | in stock | $709.00 | $496.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE36339 |
Chemical Name: | 9-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
CAS Number: | 1217891-71-8 |
Molecular Formula: | C19H22BNO2 |
Molecular Weight: | 307.19448 |
MDL Number: | MFCD16294552 |
SMILES: | Cn1c2ccc(cc2c2c1cccc2)B1OC(C(O1)(C)C)(C)C |
Complexity: | 450 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 1 |
9-Methyl-3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole is a versatile compound widely used in chemical synthesis. This compound serves as a valuable building block for the creation of organic molecules with specific properties and functionalities. Its unique structural features make it a crucial tool in the development of new materials, pharmaceuticals, and agrochemicals. By incorporating this compound into various reaction pathways, chemists can tailor the synthesis of complex molecules with precision and efficiency. Its presence enables the introduction of functional groups and stereochemical control in organic synthesis, making it an indispensable component in modern chemical research and development.