AA54492
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $70.00 | $49.00 | - + | |
1g | 98% | in stock | $186.00 | $130.00 | - + | |
5g | 98% | in stock | $667.00 | $467.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA54492 |
Chemical Name: | 3-(t-Butyldimethylsilyloxy)-5-(methoxycarbonyl)phenylboronic acid, pinacol ester |
CAS Number: | 1218789-68-4 |
Molecular Formula: | C20H33BO5Si |
Molecular Weight: | 392.3695199999999 |
MDL Number: | MFCD12546599 |
SMILES: | COC(=O)c1cc(cc(c1)B1OC(C(O1)(C)C)(C)C)O[Si](C(C)(C)C)(C)C |
Methyl 3-((tert-butyldimethylsilyl)oxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate is a versatile compound utilized in organic chemical synthesis as a key building block. This compound is commonly employed in the protection of hydroxyl groups in various organic molecules, particularly in the synthesis of complex natural products and pharmaceutical compounds. The tert-butyldimethylsilyl (TBS) protecting group attached to the hydroxyl group provides stability during various chemical reactions, allowing selective deprotection at a later stage. Additionally, the boronate ester functionality in this compound serves as a useful handle for cross-coupling reactions, enabling the introduction of diverse functional groups or moieties in a controlled manner. Overall, the strategic incorporation of Methyl 3-((tert-butyldimethylsilyl)oxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate in chemical synthesis facilitates the efficient construction of complex molecular architectures with high precision and selectivity.