AA54528
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $60.00 | $42.00 | - + | |
250mg | 97% | in stock | $105.00 | $73.00 | - + | |
1g | 97% | in stock | $259.00 | $181.00 | - + | |
5g | 97% | in stock | $907.00 | $635.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA54528 |
Chemical Name: | 5-Acetamido-2-chlorophenylboronic acid, pinacol ester |
CAS Number: | 1218789-92-4 |
Molecular Formula: | C14H19BClNO3 |
Molecular Weight: | 295.5696 |
MDL Number: | MFCD15143594 |
SMILES: | CC(=O)Nc1ccc(c(c1)B1OC(C(O1)(C)C)(C)C)Cl |
Complexity: | 373 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
The product, N-(4-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide, plays a crucial role in chemical synthesis as a versatile building block for the creation of various organic compounds. It is commonly utilized as a key intermediate in the production of pharmaceuticals, agrochemicals, and advanced materials due to its unique structural properties and reactivity. This compound facilitates the introduction of specific functional groups into complex molecules and enables the synthesis of novel compounds with enhanced properties. Its application in chemical synthesis offers researchers and chemists a valuable tool for the development of innovative and high-value products in a range of industries.