AA54557
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $212.00 | $148.00 | - + | |
250mg | 95% | in stock | $355.00 | $248.00 | - + | |
1g | 95% | in stock | $712.00 | $498.00 | - + | |
5g | 95% | in stock | $2,915.00 | $2,040.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA54557 |
Chemical Name: | 1-BOC-7-Methoxyindole-3-boronic acid, pinacol ester |
CAS Number: | 1218790-26-1 |
Molecular Formula: | C20H28BNO5 |
Molecular Weight: | 373.251 |
MDL Number: | MFCD14155739 |
SMILES: | COc1cccc2c1n(cc2B1OC(C(O1)(C)C)(C)C)C(=O)OC(C)(C)C |
Complexity: | 557 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 4 |
The tert-Butyl 7-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate is a versatile compound used in chemical synthesis for the formation of complex organic molecules. It serves as a key building block in the construction of various pharmaceuticals, agrochemicals, and advanced materials. This compound plays a crucial role in Suzuki-Miyaura cross-coupling reactions, a powerful method for forming carbon-carbon bonds in synthetic chemistry. Additionally, its unique structural features make it a valuable tool for developing novel chemical entities with enhanced properties and functionalities.