logo
Home  > 2-(4-(t-Butoxycarbonyl)piperazin-1-yl)pyridine-3-boronic acid

AA54607

1218790-78-3 | 2-(4-(t-Butoxycarbonyl)piperazin-1-yl)pyridine-3-boronic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 97% in stock $201.00 $141.00 -   +
5g 97% in stock $758.00 $531.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA54607
Chemical Name: 2-(4-(t-Butoxycarbonyl)piperazin-1-yl)pyridine-3-boronic acid
CAS Number: 1218790-78-3
Molecular Formula: C14H22BN3O4
Molecular Weight: 307.1532
MDL Number: MFCD13195677
SMILES: O=C(N1CCN(CC1)c1ncccc1B(O)O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The compound (2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)pyridin-3-yl)boronic acid, also known as $name$, is utilized in chemical synthesis as a versatile building block for the formation of various organic molecules. Its boronic acid functionality allows for the formation of stable covalent bonds with certain reactive groups, such as aryl halides, enabling the compound to be employed in Suzuki-Miyaura cross-coupling reactions. This reaction is widely used in the synthesis of complex organic compounds, including pharmaceuticals, agrochemicals, and materials science. Furthermore, the presence of the piperazine moiety in $name$ provides opportunities for further derivatization, making it a valuable tool in medicinal chemistry for the development of novel drug candidates.
FEATURED PRODUCTS