AA54621
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $201.00 | $141.00 | - + | |
5g | 96% | in stock | $572.00 | $400.00 | - + | |
10g | 96% | in stock | $1,007.00 | $705.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA54621 |
Chemical Name: | 1-Methylpyrrole-2,5-diboronoic acid, pinacol ester |
CAS Number: | 1218791-17-3 |
Molecular Formula: | C17H29B2NO4 |
Molecular Weight: | 333.0385 |
MDL Number: | MFCD13195753 |
SMILES: | CC1(C)OB(OC1(C)C)c1ccc(n1C)B1OC(C(O1)(C)C)(C)C |
Complexity: | 433 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
1-Methyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole is a versatile compound commonly utilized in chemical synthesis. This compound serves as a valuable building block in organic chemistry, particularly in the field of cross-coupling reactions. Its unique structure enables it to participate in a variety of coupling reactions, leading to the formation of complex molecular architectures with high efficiency and selectivity. Additionally, the presence of boron atoms in its structure imparts desirable properties for further functionalization and modification, making it a valuable tool for the synthesis of pharmaceuticals, agrochemicals, and advanced materials.