AB53595
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $115.00 | $81.00 | - + | |
5mg | ≥98% | in stock | $508.00 | $356.00 | - + | |
10mg | ≥98% | in stock | $900.00 | $630.00 | - + | |
25mg | ≥98% | in stock | $1,685.00 | $1,179.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53595 |
Chemical Name: | Mk-7246 |
CAS Number: | 1218918-62-7 |
Molecular Formula: | C21H21FN2O4S |
Molecular Weight: | 416.4658 |
MDL Number: | MFCD22741619 |
SMILES: | OC(=O)Cc1c2CC[C@H](Cn2c2c1cccc2)N(S(=O)(=O)c1ccc(cc1)F)C |
Complexity: | 704 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 2.8 |
Clinical pharmacology and therapeutics 20120701
The Journal of organic chemistry 20120302
Journal of medicinal chemistry 20111027
Bioorganic & medicinal chemistry letters 20110601
Bioorganic & medicinal chemistry letters 20110115
Molecular pharmacology 20110101
Bioorganic & medicinal chemistry letters 20110101