AA54710
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $33.00 | $23.00 | - + | |
250mg | 96% | in stock | $55.00 | $38.00 | - + | |
500mg | 96% | in stock | $86.00 | $60.00 | - + | |
1g | 96% | in stock | $123.00 | $86.00 | - + | |
2g | 96% | in stock | $226.00 | $158.00 | - + | |
5g | 96% | in stock | $563.00 | $394.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA54710 |
Chemical Name: | 5-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid |
CAS Number: | 1219-33-6 |
Molecular Formula: | C13H10O5 |
Molecular Weight: | 246.2155 |
MDL Number: | MFCD15143595 |
SMILES: | OC(=O)c1occ(c(=O)c1)OCc1ccccc1 |
Complexity: | 402 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.5 |
In chemical synthesis, 5-(Benzyloxy)-4-oxo-4H-pyran-2-carboxylic acid can serve as a versatile building block for the creation of various organic compounds. This compound features a pyran ring structure attached to a carboxylic acid functional group, making it a valuable intermediate in the development of complex molecules. Its unique structural properties make it suitable for use in the synthesis of pharmaceuticals, agrochemicals, and materials with specialized properties. By incorporating 5-(Benzyloxy)-4-oxo-4H-pyran-2-carboxylic acid into synthetic pathways, chemists can access a diverse range of structurally diverse compounds, enhancing the scope of chemical research and development.
European journal of medicinal chemistry 20090501