AE79316
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $43.00 | $30.00 | - + | |
250mg | 95% | in stock | $73.00 | $51.00 | - + | |
1g | 95% | in stock | $186.00 | $130.00 | - + | |
5g | 95% | in stock | $921.00 | $645.00 | - + | |
10g | 95% | in stock | $1,535.00 | $1,074.00 | - + | |
25g | 95% | in stock | $3,058.00 | $2,141.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE79316 |
Chemical Name: | 6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one |
CAS Number: | 1219130-56-9 |
Molecular Formula: | C15H18BNO3 |
Molecular Weight: | 271.1193 |
MDL Number: | MFCD18426474 |
SMILES: | O=c1[nH]ccc2c1ccc(c2)B1OC(C(O1)(C)C)(C)C |
Complexity: | 430 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1(2H)-isoquinolinone, a versatile compound in chemical synthesis, acts as a key building block for the creation of complex organic molecules. This unique compound serves as a potent source of boron in organic reactions, enabling the formation of carbon-carbon and carbon-heteroatom bonds with high efficiency and selectivity. In the field of drug discovery and material science, this compound plays a crucial role in the development of novel pharmaceuticals, agrochemicals, and functional materials. Its strategic incorporation into synthetic pathways facilitates the construction of diverse molecular structures with enhanced properties and functionalities, making it a valuable tool for chemists seeking to innovate and advance their research endeavors.