BG18719
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 98% | 2 weeks | $276.00 | $194.00 | - + | |
100mg | 98% | 2 weeks | $455.00 | $319.00 | - + | |
250mg | 98% | 2 weeks | $901.00 | $631.00 | - + | |
1g | 98% | 2 weeks | $2,012.00 | $1,409.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BG18719 |
Chemical Name: | (2S,5S)-1-(((9H-FLUOREN-9-YL)METHOXY)CARBONYL)-5-PHENYLPYRROLIDINE-2-CARBOXYLIC ACID |
CAS Number: | 1219953-60-2 |
Molecular Formula: | C26H23NO4 |
Molecular Weight: | 413.4651 |
MDL Number: | MFCD20527645 |
SMILES: | OC(=O)[C@@H]1CC[C@H](N1C(=O)OCC1c2ccccc2-c2c1cccc2)c1ccccc1 |
(2S,5S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-5-phenylpyrrolidine-2-carboxylic acid is a versatile compound widely utilized in chemical synthesis. This compound serves as a key building block for the synthesis of various pharmaceuticals, including potential drugs targeting specific biological pathways. Its unique structure and functional groups make it a valuable tool in the development of novel molecules with desired biological activities. Additionally, (2S,5S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-5-phenylpyrrolidine-2-carboxylic acid plays a crucial role in medicinal chemistry research, allowing chemists to explore new synthetic strategies and optimize drug candidates for improved efficacy and safety profiles.