AB53875
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $63.00 | $45.00 | - + | |
250mg | 95% | in stock | $105.00 | $74.00 | - + | |
1g | 95% | in stock | $393.00 | $275.00 | - + | |
5g | 95% | in stock | $1,356.00 | $949.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53875 |
Chemical Name: | 3-Fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
CAS Number: | 1220696-64-9 |
Molecular Formula: | C12H17BFNO2 |
Molecular Weight: | 237.0783 |
MDL Number: | MFCD18382856 |
SMILES: | Cc1ncc(cc1F)B1OC(C(O1)(C)C)(C)C |
Complexity: | 282 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
3-Fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a valuable reagent in chemical synthesis due to its unique structural properties. This compound serves as a versatile building block in the creation of novel organic molecules, particularly in the realm of pharmaceutical development and material science. Its fluoro and methyl substituents confer desirable reactivity and selectivity in various synthetic transformations, making it a sought-after reagent in modern organic chemistry practices. The incorporation of the dioxaborolane moiety further enhances its utility by participating in cross-coupling reactions, enabling the construction of complex molecular architectures with high efficiency. In essence, 3-Fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine plays a crucial role in advancing the frontiers of chemical synthesis by enabling the synthesis of structurally diverse and biologically relevant compounds.