AI14499
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $8.00 | $5.00 | - + | |
10g | 95% | in stock | $13.00 | $9.00 | - + | |
100g | 95% | in stock | $102.00 | $71.00 | - + | |
500g | 95% | in stock | $429.00 | $300.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI14499 |
Chemical Name: | 2-Deoxy-2,2-difluoro-D-erythro-pentonic acid gamma lactone 3,5-dibenzoate |
CAS Number: | 122111-01-7 |
Molecular Formula: | C19H14F2O6 |
Molecular Weight: | 376.30766639999996 |
MDL Number: | MFCD00209570 |
SMILES: | O=C(c1ccccc1)OC[C@H]1OC(=O)C([C@@H]1OC(=O)c1ccccc1)(F)F |
Complexity: | 567 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 8 |
Rotatable Bond Count: | 7 |
XLogP3: | 3.8 |
The compound ((2R,3R)-3-(Benzoyloxy)-4,4-difluoro-5-oxotetrahydrofuran-2-yl)methyl benzoate plays a crucial role in chemical synthesis as a versatile building block. Its unique structure enables it to serve as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. This compound acts as a valuable precursor in the creation of structurally complex molecules due to its ability to undergo selective functional group transformations, such as esterifications, amidations, and nucleophilic substitutions. Additionally, its difluoromethyl ketone moiety offers synthetic chemists a valuable tool for introducing fluorine into organic molecules, which can significantly impact the physicochemical properties and biological activities of the final products.