AI14500
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $18.00 | $12.00 | - + | |
1g | 98% | in stock | $28.00 | $20.00 | - + | |
5g | 98% | in stock | $76.00 | $53.00 | - + | |
10g | 98% | in stock | $123.00 | $86.00 | - + | |
25g | 98% | in stock | $293.00 | $205.00 | - + | |
100g | 98% | in stock | $622.00 | $436.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI14500 |
Chemical Name: | 2-Deoxy-2,2-difluoro-d-erythro-pentofuranose-3,5-dibenzoate-1-methanesulfonate |
CAS Number: | 122111-11-9 |
Molecular Formula: | C20H18F2O8S |
Molecular Weight: | 456.4139 |
MDL Number: | MFCD08460089 |
SMILES: | O=C(c1ccccc1)OC[C@H]1OC(C([C@@H]1OC(=O)c1ccccc1)(F)F)OS(=O)(=O)C |
Complexity: | 739 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 10 |
Rotatable Bond Count: | 9 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 3.3 |
The compound ((2R,3R)-3-(Benzoyloxy)-4,4-difluoro-5-((methylsulfonyl)oxy)tetrahydrofuran-2-yl)methyl benzoate plays a crucial role in chemical synthesis as a versatile building block. Its unique structure and functional groups make it an ideal precursor for the synthesis of complex organic molecules. This compound is commonly used as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its reactivity and stability under different reaction conditions make it a valuable tool for chemists to access structurally diverse compounds efficiently. In addition, the presence of the benzoyloxy and methylsulfonyl groups enables selective functionalization, allowing for precise control over the synthesis of target molecules. Overall, the utilization of ((2R,3R)-3-(Benzoyloxy)-4,4-difluoro-5-((methylsulfonyl)oxy)tetrahydrofuran-2-yl)methyl benzoate in chemical synthesis highlights its significance in enabling the construction of intricate molecular architectures.