AE45728
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $68.00 | $47.00 | - + | |
250mg | 97% | in stock | $112.00 | $78.00 | - + | |
1g | 97% | in stock | $350.00 | $245.00 | - + | |
5g | 97% | in stock | $1,258.00 | $881.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE45728 |
Chemical Name: | 2-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoindolin-1-one |
CAS Number: | 1221239-09-3 |
Molecular Formula: | C15H20BNO3 |
Molecular Weight: | 273.1352 |
MDL Number: | MFCD18205310 |
SMILES: | CN1Cc2c(C1=O)cccc2B1OC(C(O1)(C)C)(C)C |
2-Methyl-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-2,3-dihydro-isoindol-1-one, commonly known as $name$, is a versatile chemical compound widely utilized in chemical synthesis due to its unique properties. In organic chemistry, $name$ serves as a valuable reagent for the introduction of the boron functional group into various organic molecules. This compound acts as a key building block in the synthesis of boronic acid derivatives, which are essential intermediates in the formation of complex organic compounds.$name$ finds extensive application in Suzuki-Miyaura cross-coupling reactions, a fundamental methodology in modern organic synthesis for forming carbon-carbon bonds. By participating in these coupling reactions, $name$ enables the efficient assembly of biaryl compounds, which are prevalent in pharmaceuticals, agrochemicals, and materials science. Additionally, $name$ plays a crucial role in the synthesis of heterocyclic compounds, facilitating the creation of diverse molecular scaffolds with potential applications in medicinal chemistry and materials research.Furthermore, the unique structural features of $name$, including the boron-containing moiety and the isoindolone ring system, make it a valuable tool for the preparation of complex organic molecules with specific functionalities. Its ability to participate in various chemical transformations highlights its significance in the construction of structurally diverse compounds for a range of applications in the field of organic chemistry.